CAS No: 29584-42-7, Chemical Name: sulfur trioxide dimethylformamide complex
Chemical CAS Database with Global Chemical Suppliers - ChemNet
the physical and chemical property of 29584-42-7, sulfur trioxide dimethylformamide complex is provided by ChemNet.com

  ChemNet > CAS > 29584-42-7 sulfur trioxide dimethylformamide complex

29584-42-7 sulfur trioxide dimethylformamide complex

Название продукта sulfur trioxide dimethylformamide complex
Синонимы N,N-dimethylformamide-oxosulfane dioxide (1:1)
Молекулярная формула C3H7NO4S
Молекулярный вес 153.157
InChI InChI=1/C3H7NO.O3S/c1-4(2)3-5;1-4(2)3/h3H,1-2H3;
Регистрационный номер CAS 29584-42-7
EINECS 249-701-5
Молекулярная структура 29584-42-7 sulfur trioxide dimethylformamide complex
Температура плавления 155-158℃
Точка кипения 153°C at 760 mmHg
Температура вспышки 57.8°C
Символы опасности
Риск коды
Характеристики безопасности