ChemNet > CAS > 36847-94-6 N-(2-Methoxyphenyl)maleamic acid
36847-94-6 N-(2-Methoxyphenyl)maleamic acid
Название продукта |
N-(2-Methoxyphenyl)maleamic acid |
Синонимы |
(2Z)-4-[(2-methoxyphenyl)amino]-4-oxobut-2-enoic acid; (2E)-4-[(2-methoxyphenyl)amino]-4-oxobut-2-enoate |
Молекулярная формула |
C11H10NO4 |
Молекулярный вес |
220.2019 |
InChI |
InChI=1/C11H11NO4/c1-16-9-5-3-2-4-8(9)12-10(13)6-7-11(14)15/h2-7H,1H3,(H,12,13)(H,14,15)/p-1/b7-6+ |
Регистрационный номер CAS |
36847-94-6 |
Молекулярная структура |
|
Точка кипения |
468.9°C at 760 mmHg |
Температура вспышки |
237.4°C |
Символы опасности |
|
Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|