ChemNet > CAS > 36919-03-6 Methyl pentafluorophenyl carbonate
36919-03-6 Methyl pentafluorophenyl carbonate
Название продукта |
Methyl pentafluorophenyl carbonate |
Синонимы |
Pentafluorophenyl methyl carbonate |
Молекулярная формула |
C8H3F5O3 |
Молекулярный вес |
242.0996 |
InChI |
InChI=1/C8H3F5O3/c1-15-8(14)16-7-5(12)3(10)2(9)4(11)6(7)13/h1H3 |
Регистрационный номер CAS |
36919-03-6 |
Молекулярная структура |
|
Плотность |
1.567g/cm3 |
Точка кипения |
207.5°C at 760 mmHg |
Показатель преломления |
1.422 |
Температура вспышки |
77.3°C |
Символы опасности |
|
Риск коды |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|