ChemNet > CAS > 39842-01-8 2,4-Dimethylphenyl isothiocyanate
39842-01-8 2,4-Dimethylphenyl isothiocyanate
| Название продукта |
2,4-Dimethylphenyl isothiocyanate |
| Синонимы |
2,4-Dimethylisothiocyanatobenzene; 1-isothiocyanato-2,4-dimethylbenzene |
| Молекулярная формула |
C9H9NS |
| Молекулярный вес |
163.2395 |
| InChI |
InChI=1/C9H9NS/c1-7-3-4-9(10-6-11)8(2)5-7/h3-5H,1-2H3 |
| Регистрационный номер CAS |
39842-01-8 |
| Молекулярная структура |
|
| Плотность |
1.01g/cm3 |
| Точка кипения |
265.8°C at 760 mmHg |
| Показатель преломления |
1.554 |
| Температура вспышки |
115.8°C |
| Символы опасности |
|
| Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
