ChemNet > CAS > 41764-74-3 3,4-Dimethoxybenzoic acid hydrazide
41764-74-3 3,4-Dimethoxybenzoic acid hydrazide
Название продукта |
3,4-Dimethoxybenzoic acid hydrazide |
Синонимы |
3,4-Dimethoxybenzhydrazide; 3,4-dimethoxybenzohydrazide |
Молекулярная формула |
C9H12N2O3 |
Молекулярный вес |
196.2032 |
InChI |
InChI=1/C9H12N2O3/c1-13-7-4-3-6(9(12)11-10)5-8(7)14-2/h3-5H,10H2,1-2H3,(H,11,12) |
Регистрационный номер CAS |
41764-74-3 |
EINECS |
255-541-7 |
Молекулярная структура |
|
Плотность |
1.189g/cm3 |
Показатель преломления |
1.544 |
Символы опасности |
|
Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|