ChemNet > CAS > 55776-17-5 2,6-Dimethoxy-3-nitrobenzoic acid
55776-17-5 2,6-Dimethoxy-3-nitrobenzoic acid
| Название продукта |
2,6-Dimethoxy-3-nitrobenzoic acid |
| Молекулярная формула |
C9H9NO6 |
| Молекулярный вес |
227.1709 |
| InChI |
InChI=1/C9H9NO6/c1-15-6-4-3-5(10(13)14)8(16-2)7(6)9(11)12/h3-4H,1-2H3,(H,11,12) |
| Регистрационный номер CAS |
55776-17-5 |
| EINECS |
259-814-1 |
| Молекулярная структура |
|
| Плотность |
1.403g/cm3 |
| Точка кипения |
420.7°C at 760 mmHg |
| Показатель преломления |
1.569 |
| Температура вспышки |
208.2°C |
| Символы опасности |
|
| Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
