ChemNet > CAS > 627-04-3 (Ethylthio)acetic acid
627-04-3 (Ethylthio)acetic acid
Название продукта |
(Ethylthio)acetic acid |
Синонимы |
S-Ethylthioglycolic acid; (ethylsulfanyl)acetic acid |
Молекулярная формула |
C4H8O2S |
Молекулярный вес |
120.1701 |
InChI |
InChI=1/C4H8O2S/c1-2-7-3-4(5)6/h2-3H2,1H3,(H,5,6) |
Регистрационный номер CAS |
627-04-3 |
EINECS |
210-979-8 |
Молекулярная структура |
|
Плотность |
1.164g/cm3 |
Точка кипения |
229°C at 760 mmHg |
Показатель преломления |
1.496 |
Температура вспышки |
92.3°C |
Символы опасности |
|
Риск коды |
R34:Causes burns.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|