ChemNet > CAS > 627-95-2 5-Aminovaleric acid hydrochloride
627-95-2 5-Aminovaleric acid hydrochloride
Название продукта |
5-Aminovaleric acid hydrochloride |
Синонимы |
4-carboxybutylammonium chloride; 5-Aminopentanoic acid hydrochloride; 5-aminopentanoic acid; 5-aminopentanoic acid hydrochloride (1:1) |
Молекулярная формула |
C5H12ClNO2 |
Молекулярный вес |
153.6073 |
InChI |
InChI=1/C5H11NO2.ClH/c6-4-2-1-3-5(7)8;/h1-4,6H2,(H,7,8);1H |
Регистрационный номер CAS |
627-95-2 |
EINECS |
211-021-1 |
Молекулярная структура |
|
Температура плавления |
95-99℃ |
Точка кипения |
247.5°C at 760 mmHg |
Температура вспышки |
103.5°C |
Символы опасности |
|
Риск коды |
|
Характеристики безопасности |
S24/25:Avoid contact with skin and eyes.;
|
|