ChemNet > CAS > 6496-89-5 2,4-Dimethoxyphenylacetic acid
6496-89-5 2,4-Dimethoxyphenylacetic acid
| Название продукта |
2,4-Dimethoxyphenylacetic acid |
| Синонимы |
(2,4-dimethoxyphenyl)acetate |
| Молекулярная формула |
C10H12O4 |
| Молекулярный вес |
195.1925 |
| InChI |
InChI=1/C10H12O4/c1-13-8-4-3-7(5-10(11)12)9(6-8)14-2/h3-4,6H,5H2,1-2H3,(H,11,12)/p-1 |
| Регистрационный номер CAS |
6496-89-5 |
| Молекулярная структура |
|
| Температура плавления |
110-113℃ |
| Точка кипения |
339.7°C at 760 mmHg |
| Температура вспышки |
134.1°C |
| Символы опасности |
 Xn:Harmful;
|
| Риск коды |
R22:;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
