ChemNet > CAS > 66003-76-7 diphenyliodonium trifluoromethane-sulfonate
66003-76-7 diphenyliodonium trifluoromethane-sulfonate
Название продукта |
diphenyliodonium trifluoromethane-sulfonate |
Синонимы |
Diphenyliodonium Trifluoromethanesulfonate; Diphenyliodonium triflate |
Молекулярная формула |
C13H10F3IO3S |
Молекулярный вес |
430.1814 |
InChI |
InChI=1/C12H10I.CHF3O3S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2-1(3,4)8(5,6)7/h1-10H;(H,5,6,7)/q+1;/p-1 |
Регистрационный номер CAS |
66003-76-7 |
Молекулярная структура |
|
Температура плавления |
177-179℃ |
Символы опасности |
|
Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|