ChemNet > CAS > 68052-36-8 benzoic acid, compound with 2-(diethylamino)ethanol (1:1)
68052-36-8 benzoic acid, compound with 2-(diethylamino)ethanol (1:1)
| Название продукта |
benzoic acid, compound with 2-(diethylamino)ethanol (1:1) |
| Синонимы |
Ethanol, 2-(diethylamino)-, benzoate (1:1); Diethylethanolamine benzoate; Benzoic acid, compound with 2-(diethylamino)ethanol (1:1); Ethanol, 2-(diethylamino)-, benzoate (salt); 2-(diethylamino)ethanol benzoate (1:1) |
| Молекулярная формула |
C13H21NO3 |
| Молекулярный вес |
239.3107 |
| InChI |
InChI=1/C7H6O2.C6H15NO/c8-7(9)6-4-2-1-3-5-6;1-3-7(4-2)5-6-8/h1-5H,(H,8,9);8H,3-6H2,1-2H3 |
| Регистрационный номер CAS |
68052-36-8 |
| EINECS |
268-318-4 |
| Молекулярная структура |
|
| Точка кипения |
249.3°C at 760 mmHg |
| Температура вспышки |
111.4°C |
| Символы опасности |
|
| Риск коды |
|
| Характеристики безопасности |
|
|
