ChemNet > CAS > 771-56-2 methyl pentafluorobenzene
771-56-2 methyl pentafluorobenzene
Название продукта |
methyl pentafluorobenzene |
Синонимы |
2,3,4,5,6-Pentafluorotoluene; Methylpentafluorobenzene |
Молекулярная формула |
C7H3F5 |
Молекулярный вес |
182.09 |
InChI |
InChI=1/C7H3F5/c1-2-3(8)5(10)7(12)6(11)4(2)9/h1H3 |
Регистрационный номер CAS |
771-56-2 |
EINECS |
212-233-7 |
Молекулярная структура |
|
Плотность |
1.44 |
Точка кипения |
117℃ |
Символы опасности |
|
Риск коды |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Характеристики безопасности |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|