CAS No: 91465-71-3, Chemical Name: 1,2,3,4,4a,5,8,8a-octahydro-1,4-methanonaphthalene
the physical and chemical property of 91465-71-3, 1,2,3,4,4a,5,8,8a-octahydro-1,4-methanonaphthalene is provided by ChemNet.com
ChemNet > CAS > 91465-71-3 1,2,3,4,4a,5,8,8a-octahydro-1,4-methanonaphthalene
91465-71-3 1,2,3,4,4a,5,8,8a-octahydro-1,4-methanonaphthalene
Название продукта |
1,2,3,4,4a,5,8,8a-octahydro-1,4-methanonaphthalene |
Синонимы |
1,4-methanonaphthalene, 1,2,3,4,4a,5,8,8a-octahydro-; Tricyclo(6.2.1.0(2,7))undec-4-ene; Tricyclo[6.2.1.0~2,7~]undec-4-ene |
Молекулярная формула |
C11H16 |
Молекулярный вес |
148.2447 |
InChI |
InChI=1/C11H16/c1-2-4-11-9-6-5-8(7-9)10(11)3-1/h1-2,8-11H,3-7H2 |
Регистрационный номер CAS |
91465-71-3 |
Молекулярная структура |
|
Плотность |
0.985g/cm3 |
Точка кипения |
208.8°C at 760 mmHg |
Показатель преломления |
1.529 |
Температура вспышки |
70.6°C |
Символы опасности |
|
Риск коды |
|
Характеристики безопасности |
|
|