ChemNet > CAS > 10192-85-5 Potassium acrylate
10192-85-5 Potassium acrylate
| اسم المنتج |
Potassium acrylate |
| الاسم المستعار |
PotassiumAcrylateinmethanol; Potassiumacrylate; Acrylic acid potassium salt; 2-Propenoic acid, potassium salt; prop-2-enoic acid; potassium prop-2-enoate |
| الصيغة الجزيئية |
C3H3KO2 |
| الوزن الجزيئي الغرامي |
110.153 |
| InChI |
InChI=1/C3H4O2.K/c1-2-3(4)5;/h2H,1H2,(H,4,5);/q;+1/p-1 |
| إستراتيجية المساعدة القطرية |
10192-85-5 |
| المفوضية الأوروبية رقم |
233-473-9 |
| بنية جزيئية |
|
| درجة الإنصهار |
194℃ |
| نقطة الغليان |
141°C at 760 mmHg |
| نقطة الوميض |
61.6°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|
