ChemNet > CAS > 1187-34-4 ethyl N-(2-cyano-3-ethoxyacryloyl)carbamate
1187-34-4 ethyl N-(2-cyano-3-ethoxyacryloyl)carbamate
| اسم المنتج |
ethyl N-(2-cyano-3-ethoxyacryloyl)carbamate |
| الاسم المستعار |
ethyl [(2E)-2-cyano-3-ethoxyprop-2-enoyl]carbamate |
| الصيغة الجزيئية |
C9H12N2O4 |
| الوزن الجزيئي الغرامي |
212.2026 |
| InChI |
InChI=1/C9H12N2O4/c1-3-14-6-7(5-10)8(12)11-9(13)15-4-2/h6H,3-4H2,1-2H3,(H,11,12,13)/b7-6+ |
| إستراتيجية المساعدة القطرية |
1187-34-4 |
| بنية جزيئية |
|
| كثافة |
1.181g/cm3 |
| درجة الإنصهار |
116℃ |
| معامل الإنكسار |
1.476 |
| علامات على البضائع الخطرة |
 Xn:Harmful;
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| شروط الأمن |
S36/37:Wear suitable protective clothing and gloves.;
|
|
