CAS No: 13289-97-9, Chemical Name: Borane-N,N-diethylaniline complex
Chemical CAS Database with Global Chemical Suppliers - ChemNet
the physical and chemical property of 13289-97-9, Borane-N,N-diethylaniline complex is provided by ChemNet.com

  ChemNet > CAS > 13289-97-9 Borane-N,N-diethylaniline complex

13289-97-9 Borane-N,N-diethylaniline complex

اسم المنتج Borane-N,N-diethylaniline complex
الاسم المستعار N,N-Diethylanilineborane; (N,N-diethylaniline)(trihydrido)boron; boron,N,N-diethylaniline; N,N-diethylanilinium; Borane N,N-Diethylaniline complex; Borane N,N-Diethylaniline; (N,N-diethylaniline)trihydroboron; Diethylphenylamine-borane
الصيغة الجزيئية C10H16N
الوزن الجزيئي الغرامي 150.2402
InChI InChI=1/C10H15N/c1-3-11(4-2)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3/p+1
إستراتيجية المساعدة القطرية 13289-97-9
المفوضية الأوروبية رقم 236-305-2
بنية جزيئية 13289-97-9 Borane-N,N-diethylaniline complex
درجة الإنصهار -30--27℃
نقطة الغليان 213.5°C at 760 mmHg
نقطة الوميض 97.8°C
الذوبان في الماء MAY DECOMPOSE
علامات على البضائع الخطرة
خطر المصطلحات R10:;
شروط الأمن S16:;
S33:;
S9:;