ChemNet > CAS > 14294-09-8 1-Piperidinethiocarboxamide
14294-09-8 1-Piperidinethiocarboxamide
اسم المنتج |
1-Piperidinethiocarboxamide |
الاسم المستعار |
piperidine-1-carbothioamide |
الصيغة الجزيئية |
C6H12N2S |
الوزن الجزيئي الغرامي |
144.2379 |
InChI |
InChI=1/C6H12N2S/c7-6(9)8-4-2-1-3-5-8/h1-5H2,(H2,7,9) |
إستراتيجية المساعدة القطرية |
14294-09-8 |
بنية جزيئية |
|
كثافة |
1.165g/cm3 |
نقطة الغليان |
237.3°C at 760 mmHg |
معامل الإنكسار |
1.593 |
نقطة الوميض |
97.3°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R20/22:Harmful by inhalation and if swallowed.;
|
شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|