ChemNet > CAS > 1475-13-4 2,4-Dichloro-Alpha-methylbenzyl alcohol
1475-13-4 2,4-Dichloro-Alpha-methylbenzyl alcohol
| اسم المنتج |
2,4-Dichloro-Alpha-methylbenzyl alcohol |
| الاسم المستعار |
Benzyl alcohol, 2,4-dichloro-alpha-methyl-; 1-(2,4-dichlorophenyl)ethanol; (1S)-1-(2,4-dichlorophenyl)ethanol; (1R)-1-(2,4-dichlorophenyl)ethanol; 2,4-Dichloro-a-methylbenzyl alcohol |
| الصيغة الجزيئية |
C8H8Cl2O |
| الوزن الجزيئي الغرامي |
191.0545 |
| InChI |
InChI=1/C8H8Cl2O/c1-5(11)7-3-2-6(9)4-8(7)10/h2-5,11H,1H3/t5-/m1/s1 |
| إستراتيجية المساعدة القطرية |
1475-13-4 |
| المفوضية الأوروبية رقم |
216-019-4 |
| بنية جزيئية |
|
| كثافة |
1.323g/cm3 |
| نقطة الغليان |
270.7°C at 760 mmHg |
| معامل الإنكسار |
1.566 |
| نقطة الوميض |
115.6°C |
| علامات على البضائع الخطرة |
 Xi:Irritant;
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
