ChemNet > CAS > 177787-26-7 3,4,5-trifluorobenzoyl chloride
177787-26-7 3,4,5-trifluorobenzoyl chloride
اسم المنتج |
3,4,5-trifluorobenzoyl chloride |
الصيغة الجزيئية |
C7H2ClF3O |
الوزن الجزيئي الغرامي |
194.5384 |
InChI |
InChI=1/C7H2ClF3O/c8-7(12)3-1-4(9)6(11)5(10)2-3/h1-2H |
إستراتيجية المساعدة القطرية |
177787-26-7 |
بنية جزيئية |
|
كثافة |
1.514g/cm3 |
نقطة الغليان |
184.7°C at 760 mmHg |
معامل الإنكسار |
1.479 |
نقطة الوميض |
65.5°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R34:Causes burns.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|