ChemNet > CAS > 183158-34-1 2,3-Dimethylbenzeneboronic acid
183158-34-1 2,3-Dimethylbenzeneboronic acid
اسم المنتج |
2,3-Dimethylbenzeneboronic acid |
الاسم المستعار |
2,3-Dimethylphenylboronic acid; O-XYLENE-3-BORONIC ACID; 2,3-dimethyl acid |
الصيغة الجزيئية |
C8H11BO2 |
الوزن الجزيئي الغرامي |
149.9827 |
InChI |
InChI=1/C8H11BO2/c1-6-4-3-5-8(7(6)2)9(10)11/h3-5,10-11H,1-2H3 |
إستراتيجية المساعدة القطرية |
183158-34-1 |
بنية جزيئية |
|
كثافة |
1.07g/cm3 |
درجة الإنصهار |
174-180℃ |
نقطة الغليان |
312.6°C at 760 mmHg |
معامل الإنكسار |
1.523 |
نقطة الوميض |
142.8°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|