ChemNet > CAS > 18719-43-2 diethyl (3-chloropropyl)malonate
18719-43-2 diethyl (3-chloropropyl)malonate
اسم المنتج |
diethyl (3-chloropropyl)malonate |
الاسم المستعار |
(3-Chloropropyl)malonic acid diethyl ester; diethyl (3-chloropropyl)propanedioate |
الصيغة الجزيئية |
C10H17ClO4 |
الوزن الجزيئي الغرامي |
236.6926 |
InChI |
InChI=1/C10H17ClO4/c1-3-14-9(12)8(6-5-7-11)10(13)15-4-2/h8H,3-7H2,1-2H3 |
إستراتيجية المساعدة القطرية |
18719-43-2 |
بنية جزيئية |
|
كثافة |
1.114g/cm3 |
نقطة الغليان |
290.2°C at 760 mmHg |
معامل الإنكسار |
1.447 |
نقطة الوميض |
111.9°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/38:Irritating to eyes and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|