CAS No: 198021-01-1, Chemical Name: 5,8-Dimethoxy-1,2,3,4-tetrhydroisoquinoline-3-carboxylic acid ethyl ester
the physical and chemical property of 198021-01-1, 5,8-Dimethoxy-1,2,3,4-tetrhydroisoquinoline-3-carboxylic acid ethyl ester is provided by ChemNet.com
ChemNet > CAS > 198021-01-1 5,8-Dimethoxy-1,2,3,4-tetrhydroisoquinoline-3-carboxylic acid ethyl ester
198021-01-1 5,8-Dimethoxy-1,2,3,4-tetrhydroisoquinoline-3-carboxylic acid ethyl ester
| اسم المنتج |
5,8-Dimethoxy-1,2,3,4-tetrhydroisoquinoline-3-carboxylic acid ethyl ester |
| الاسم المستعار |
Ethyl 5,8-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylate; 5,8-Dimethoxy-1,2,3,4-Tetrhydro-Isoquinoline-3-Carboxylic Acid Ethyl Ester |
| الصيغة الجزيئية |
C14H19NO4 |
| الوزن الجزيئي الغرامي |
265.305 |
| InChI |
InChI=1/C14H19NO4/c1-4-19-14(16)11-7-9-10(8-15-11)13(18-3)6-5-12(9)17-2/h5-6,11,15H,4,7-8H2,1-3H3 |
| إستراتيجية المساعدة القطرية |
198021-01-1 |
| بنية جزيئية |
|
| كثافة |
1.131g/cm3 |
| نقطة الغليان |
417.6°C at 760 mmHg |
| معامل الإنكسار |
1.515 |
| نقطة الوميض |
206.4°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
|
| شروط الأمن |
|
|
