ChemNet > CAS > 2156-04-9 4-Vinylbenzeneboronic acid
2156-04-9 4-Vinylbenzeneboronic acid
اسم المنتج |
4-Vinylbenzeneboronic acid |
الاسم المستعار |
4-Vinylphenylboronic acid; Styrene-4-boronic acid; (4-ethenylphenyl)boronic acid |
الصيغة الجزيئية |
C8H9BO2 |
الوزن الجزيئي الغرامي |
147.9669 |
InChI |
InChI=1/C8H9BO2/c1-2-7-3-5-8(6-4-7)9(10)11/h2-6,10-11H,1H2 |
إستراتيجية المساعدة القطرية |
2156-04-9 |
بنية جزيئية |
|
كثافة |
1.09g/cm3 |
درجة الإنصهار |
188-189℃ |
نقطة الغليان |
306.2°C at 760 mmHg |
معامل الإنكسار |
1.539 |
نقطة الوميض |
139°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|