ChemNet > CAS > 2206-27-1 (Methyl sulfoxide)-d6
2206-27-1 (Methyl sulfoxide)-d6
| اسم المنتج |
(Methyl sulfoxide)-d6 |
| الاسم المستعار |
Dimethyl-d6 sulfoxide; (Methyl sulfoxide)-d6 with 0.03% TMS packaged in 0.75 ml ampules; dimethyl sulfoxide 99.9 atom % D; Dimethylsulfoxide-d6; Dimethyl-d6 sulphoxide + 0.05% TMS (v/v); Dimethylsulfoxidedisotopicpurity; Dimethyl sulfoxide-d6; (methylsulfinyl)methane; [(~2~H_3_)methylsulfinyl](~2~H_3_)methane |
| الصيغة الجزيئية |
C2D6OS |
| الوزن الجزيئي الغرامي |
84.1704 |
| InChI |
InChI=1/C2H6OS/c1-4(2)3/h1-2H3/i1D3,2D3 |
| إستراتيجية المساعدة القطرية |
2206-27-1 |
| المفوضية الأوروبية رقم |
218-617-0 |
| بنية جزيئية |
|
| كثافة |
1.184g/cm3 |
| درجة الإنصهار |
20-56℃ |
| نقطة الغليان |
189°C at 760 mmHg |
| معامل الإنكسار |
1.479 |
| نقطة الوميض |
85°C |
| علامات على البضائع الخطرة |
 Xi:Irritant;
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
