ChemNet > CAS > 243863-36-7 2-(difluoromethoxy)benzylamine
243863-36-7 2-(difluoromethoxy)benzylamine
اسم المنتج |
2-(difluoromethoxy)benzylamine |
الاسم المستعار |
1-[2-(difluoromethoxy)phenyl]methanamine |
الصيغة الجزيئية |
C8H9F2NO |
الوزن الجزيئي الغرامي |
173.16 |
InChI |
InChI=1/C8H9F2NO/c9-8(10)12-7-4-2-1-3-6(7)5-11/h1-4,8H,5,11H2 |
إستراتيجية المساعدة القطرية |
243863-36-7 |
بنية جزيئية |
|
كثافة |
1.196g/cm3 |
نقطة الغليان |
214.1°C at 760 mmHg |
معامل الإنكسار |
1.487 |
نقطة الوميض |
83.3°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R34:Causes burns.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|