ChemNet > CAS > 2619-88-7 Palmiticacidhydrazide
2619-88-7 Palmiticacidhydrazide
| اسم المنتج |
Palmiticacidhydrazide |
| الاسم المستعار |
Hexadecanehydrazide; hexadecanoic acid, hydrazide |
| الصيغة الجزيئية |
C16H34N2O |
| الوزن الجزيئي الغرامي |
270.454 |
| InChI |
InChI=1/C16H34N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(19)18-17/h2-15,17H2,1H3,(H,18,19) |
| إستراتيجية المساعدة القطرية |
2619-88-7 |
| بنية جزيئية |
|
| كثافة |
0.894g/cm3 |
| نقطة الغليان |
416.2°C at 760 mmHg |
| معامل الإنكسار |
1.463 |
| نقطة الوميض |
205.5°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
