ChemNet > CAS > 26351-19-9 Violuric acid monohydrate
26351-19-9 Violuric acid monohydrate
اسم المنتج |
Violuric acid monohydrate |
الاسم المستعار |
Alloxan-5-oxime monohydrate; 5-Isonitrosobarbituric acid monohydrate; 5-(hydroxyimino)pyrimidine-2,4,6(1H,3H,5H)-trione hydrate (1:1) |
الصيغة الجزيئية |
C4H5N3O5 |
الوزن الجزيئي الغرامي |
175.0996 |
InChI |
InChI=1/C4H3N3O4.H2O/c8-2-1(7-11)3(9)6-4(10)5-2;/h11H,(H2,5,6,8,9,10);1H2 |
إستراتيجية المساعدة القطرية |
26351-19-9 |
المفوضية الأوروبية رقم |
201-741-4 |
بنية جزيئية |
|
درجة الإنصهار |
236-240℃ |
نقطة الغليان |
449°C at 760 mmHg |
نقطة الوميض |
225.4°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|