CAS No: 35065-29-3, Chemical Name: 2,2',3,4,4',5,5'-heptachlorobiphenyl
the physical and chemical property of 35065-29-3, 2,2',3,4,4',5,5'-heptachlorobiphenyl is provided by ChemNet.com
ChemNet > CAS > 35065-29-3 2,2',3,4,4',5,5'-heptachlorobiphenyl
35065-29-3 2,2',3,4,4',5,5'-heptachlorobiphenyl
| اسم المنتج |
2,2',3,4,4',5,5'-heptachlorobiphenyl |
| الاسم المستعار |
1,1'-biphenyl, 2,2',3,4,4',5,5'-heptachloro-; 2,2',3,4,4',5,5'-Heptachlorobiphenyl; 2,2',3,4,4',5,5'-PCB |
| الصيغة الجزيئية |
C12H3Cl7 |
| الوزن الجزيئي الغرامي |
395.3232 |
| InChI |
InChI=1/C12H3Cl7/c13-6-3-8(15)7(14)1-4(6)5-2-9(16)11(18)12(19)10(5)17/h1-3H |
| إستراتيجية المساعدة القطرية |
35065-29-3 |
| بنية جزيئية |
|
| كثافة |
1.658g/cm3 |
| نقطة الغليان |
424.3°C at 760 mmHg |
| معامل الإنكسار |
1.632 |
| نقطة الوميض |
210.9°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
|
| شروط الأمن |
|
|
