ChemNet > CAS > 40803-53-0 5-Bromo-2-methoxycinnamic acid
40803-53-0 5-Bromo-2-methoxycinnamic acid
| اسم المنتج |
5-Bromo-2-methoxycinnamic acid |
| الاسم المستعار |
(2E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoic acid; (2E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate |
| الصيغة الجزيئية |
C10H8BrO3 |
| الوزن الجزيئي الغرامي |
256.0733 |
| InChI |
InChI=1/C10H9BrO3/c1-14-9-4-3-8(11)6-7(9)2-5-10(12)13/h2-6H,1H3,(H,12,13)/p-1/b5-2+ |
| إستراتيجية المساعدة القطرية |
40803-53-0 |
| بنية جزيئية |
|
| درجة الإنصهار |
224-227℃ |
| نقطة الغليان |
381.5°C at 760 mmHg |
| نقطة الوميض |
184.5°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
