ChemNet > CAS > 41764-74-3 3,4-Dimethoxybenzoic acid hydrazide
41764-74-3 3,4-Dimethoxybenzoic acid hydrazide
اسم المنتج |
3,4-Dimethoxybenzoic acid hydrazide |
الاسم المستعار |
3,4-Dimethoxybenzhydrazide; 3,4-dimethoxybenzohydrazide |
الصيغة الجزيئية |
C9H12N2O3 |
الوزن الجزيئي الغرامي |
196.2032 |
InChI |
InChI=1/C9H12N2O3/c1-13-7-4-3-6(9(12)11-10)5-8(7)14-2/h3-5H,10H2,1-2H3,(H,11,12) |
إستراتيجية المساعدة القطرية |
41764-74-3 |
المفوضية الأوروبية رقم |
255-541-7 |
بنية جزيئية |
|
كثافة |
1.189g/cm3 |
معامل الإنكسار |
1.544 |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|