ChemNet > CAS > 423768-53-0 ethyl 1-cyclopropyl-4-formyl-2,5-dimethyl-1H-pyrrole-3-carboxylate
423768-53-0 ethyl 1-cyclopropyl-4-formyl-2,5-dimethyl-1H-pyrrole-3-carboxylate
اسم المنتج |
ethyl 1-cyclopropyl-4-formyl-2,5-dimethyl-1H-pyrrole-3-carboxylate |
الصيغة الجزيئية |
C13H17NO3 |
الوزن الجزيئي الغرامي |
235.279 |
InChI |
InChI=1/C13H17NO3/c1-4-17-13(16)12-9(3)14(10-5-6-10)8(2)11(12)7-15/h7,10H,4-6H2,1-3H3 |
إستراتيجية المساعدة القطرية |
423768-53-0 |
بنية جزيئية |
|
كثافة |
1.21g/cm3 |
درجة الإنصهار |
75℃ |
نقطة الغليان |
391.9°C at 760 mmHg |
معامل الإنكسار |
1.571 |
نقطة الوميض |
190.8°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|