ChemNet > CAS > 4771-50-0 7-methylindole 3-carboxaldehyde
4771-50-0 7-methylindole 3-carboxaldehyde
| اسم المنتج |
7-methylindole 3-carboxaldehyde |
| الاسم المستعار |
7-Methylindole-3-carboxaldehyde; 3-Formyl-7-methylindole; 7-methyl-1H-indole-3-carbaldehyde |
| الصيغة الجزيئية |
C10H9NO |
| الوزن الجزيئي الغرامي |
159.1846 |
| InChI |
InChI=1/C10H9NO/c1-7-3-2-4-9-8(6-12)5-11-10(7)9/h2-6,11H,1H3 |
| إستراتيجية المساعدة القطرية |
4771-50-0 |
| بنية جزيئية |
|
| كثافة |
1.226g/cm3 |
| نقطة الغليان |
341°C at 760 mmHg |
| معامل الإنكسار |
1.698 |
| نقطة الوميض |
168°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
