CAS No: 488-73-3, Chemical Name: (1R,2S,4S,5R)-cyclohexane-1,2,3,4,5-pentol
the physical and chemical property of 488-73-3, (1R,2S,4S,5R)-cyclohexane-1,2,3,4,5-pentol is provided by ChemNet.com
ChemNet > CAS > 488-73-3 (1R,2S,4S,5R)-cyclohexane-1,2,3,4,5-pentol
488-73-3 (1R,2S,4S,5R)-cyclohexane-1,2,3,4,5-pentol
اسم المنتج |
(1R,2S,4S,5R)-cyclohexane-1,2,3,4,5-pentol |
الاسم المستعار |
(+)-Protoquercitol; (1R,2S,4S,5R)-Cyclohexane-1,2,3,4,5-pentol; 1,2,3,4,5-cyclohexanepentol, (1R,2S,4S,5R)-; 2-Deoxy-D-chiro-inositol; Acorn Sugar; D-1-Deoxy-muco-inositol; 1,2,3,4,5-cyclohexanepentol; cyclohexane-1,2,3,4,5-pentol |
الصيغة الجزيئية |
C6H12O5 |
الوزن الجزيئي الغرامي |
164.1565 |
InChI |
InChI=1/C6H12O5/c7-2-1-3(8)5(10)6(11)4(2)9/h2-11H,1H2/t2-,3-,4+,5+/m1/s1 |
إستراتيجية المساعدة القطرية |
488-73-3 |
بنية جزيئية |
|
كثافة |
1.796g/cm3 |
نقطة الغليان |
293.6°C at 760 mmHg |
معامل الإنكسار |
1.707 |
نقطة الوميض |
146.2°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
|
|