ChemNet > CAS > 50376-99-3 3,4-di(1-methylhydrazino)cyclobut-3-ene-1,2-dione
50376-99-3 3,4-di(1-methylhydrazino)cyclobut-3-ene-1,2-dione
| اسم المنتج |
3,4-di(1-methylhydrazino)cyclobut-3-ene-1,2-dione |
| الاسم المستعار |
3,4-bis(1-methylhydrazino)cyclobut-3-ene-1,2-dione |
| الصيغة الجزيئية |
C6H10N4O2 |
| الوزن الجزيئي الغرامي |
170.1692 |
| InChI |
InChI=1/C6H10N4O2/c1-9(7)3-4(10(2)8)6(12)5(3)11/h7-8H2,1-2H3 |
| إستراتيجية المساعدة القطرية |
50376-99-3 |
| بنية جزيئية |
|
| كثافة |
1.44g/cm3 |
| درجة الإنصهار |
201℃ |
| نقطة الغليان |
287.3°C at 760 mmHg |
| معامل الإنكسار |
1.642 |
| نقطة الوميض |
127.6°C |
| علامات على البضائع الخطرة |
 Xi:Irritant;
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
