ChemNet > CAS > 51362-38-0 6-phenoxynicotinic acid
51362-38-0 6-phenoxynicotinic acid
اسم المنتج |
6-phenoxynicotinic acid |
الاسم المستعار |
6-phenoxypyridine-3-carboxylic acid |
الصيغة الجزيئية |
C12H9NO3 |
الوزن الجزيئي الغرامي |
215.2048 |
InChI |
InChI=1/C12H9NO3/c14-12(15)9-6-7-11(13-8-9)16-10-4-2-1-3-5-10/h1-8H,(H,14,15) |
إستراتيجية المساعدة القطرية |
51362-38-0 |
بنية جزيئية |
|
كثافة |
1.298g/cm3 |
درجة الإنصهار |
164℃ |
نقطة الغليان |
391.2°C at 760 mmHg |
معامل الإنكسار |
1.613 |
نقطة الوميض |
190.4°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|