ChemNet > CAS > 51707-38-1 3,4-Dimethoxybenzhydrazide
51707-38-1 3,4-Dimethoxybenzhydrazide
اسم المنتج |
3,4-Dimethoxybenzhydrazide |
الاسم المستعار |
3,5-dimethoxybenzohydrazide; 3,5-Dimethoxybenzhydrazide |
الصيغة الجزيئية |
C9H12N2O3 |
الوزن الجزيئي الغرامي |
196.2032 |
InChI |
InChI=1/C9H12N2O3/c1-13-7-3-6(9(12)11-10)4-8(5-7)14-2/h3-5H,10H2,1-2H3,(H,11,12) |
إستراتيجية المساعدة القطرية |
51707-38-1 |
بنية جزيئية |
|
كثافة |
1.189g/cm3 |
درجة الإنصهار |
143-144℃ |
معامل الإنكسار |
1.544 |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|