ChemNet > CAS > 57338-76-8 2,5-dimethyl-1H-pyrrole-3-carboxylic acid
57338-76-8 2,5-dimethyl-1H-pyrrole-3-carboxylic acid
اسم المنتج |
2,5-dimethyl-1H-pyrrole-3-carboxylic acid |
الاسم المستعار |
2,5-Dimethylpyrrole-3-carboxylic acid; 2,5-dimethyl-1H-pyrrole-3-carboxylate |
الصيغة الجزيئية |
C7H8NO2 |
الوزن الجزيئي الغرامي |
138.1445 |
InChI |
InChI=1/C7H9NO2/c1-4-3-6(7(9)10)5(2)8-4/h3,8H,1-2H3,(H,9,10)/p-1 |
إستراتيجية المساعدة القطرية |
57338-76-8 |
بنية جزيئية |
|
درجة الإنصهار |
200℃ |
نقطة الغليان |
318.4°C at 760 mmHg |
نقطة الوميض |
146.4°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|