ChemNet > CAS > 610-16-2 2-Dimethylaminobenzoic acid
610-16-2 2-Dimethylaminobenzoic acid
اسم المنتج |
2-Dimethylaminobenzoic acid |
الاسم المستعار |
Benzoic acid, 2-(dimethylamino)-; 2-(Dimethylamino)benzoic acid; AI3-05925; N,N-Dimethylanthranilic acid; NSC 45790; Anthranilic acid, N,N-dimethyl- (8CI); 2-(dimethylamino)benzoate |
الصيغة الجزيئية |
C9H10NO2 |
الوزن الجزيئي الغرامي |
164.1817 |
InChI |
InChI=1/C9H11NO2/c1-10(2)8-6-4-3-5-7(8)9(11)12/h3-6H,1-2H3,(H,11,12)/p-1 |
إستراتيجية المساعدة القطرية |
610-16-2 |
المفوضية الأوروبية رقم |
210-209-0 |
بنية جزيئية |
|
درجة الإنصهار |
71-72℃ |
نقطة الغليان |
288.5°C at 760 mmHg |
نقطة الوميض |
128.3°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|