ChemNet > CAS > 612-23-7 2-Nitrobenzyl chloride
612-23-7 2-Nitrobenzyl chloride
| اسم المنتج |
2-Nitrobenzyl chloride |
| الاسم المستعار |
alpha-Chloro-2-nitrotoluene; a-Chloro-2-nitrotoluene); 1-chloro-2-methyl-3-nitrobenzene; 1-(chloromethyl)-2-nitrobenzene |
| الصيغة الجزيئية |
C7H6ClNO2 |
| الوزن الجزيئي الغرامي |
171.581 |
| InChI |
InChI=1/C7H6ClNO2/c8-5-6-3-1-2-4-7(6)9(10)11/h1-4H,5H2 |
| إستراتيجية المساعدة القطرية |
612-23-7 |
| المفوضية الأوروبية رقم |
210-300-5 |
| بنية جزيئية |
|
| كثافة |
1.33g/cm3 |
| درجة الإنصهار |
46-50℃ |
| نقطة الغليان |
269°C at 760 mmHg |
| معامل الإنكسار |
1.574 |
| نقطة الوميض |
112.7°C |
| علامات على البضائع الخطرة |
 C:Corrosive;
|
| خطر المصطلحات |
R34:Causes burns.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
