CAS No: 6294-79-7, Chemical Name: 1,3-di(prop-2-en-1-yl)-1,3,5-triazinane-2,4,6-trione
the physical and chemical property of 6294-79-7, 1,3-di(prop-2-en-1-yl)-1,3,5-triazinane-2,4,6-trione is provided by ChemNet.com
ChemNet > CAS > 6294-79-7 1,3-di(prop-2-en-1-yl)-1,3,5-triazinane-2,4,6-trione
6294-79-7 1,3-di(prop-2-en-1-yl)-1,3,5-triazinane-2,4,6-trione
اسم المنتج |
1,3-di(prop-2-en-1-yl)-1,3,5-triazinane-2,4,6-trione |
الاسم المستعار |
1,3,5-triazine-2,4,6(1H,3H,5H)-trione, 1,3-di-2-propen-1-yl-; 1,3-Diallyl-1,3,5-triazinane-2,4,6-trione |
الصيغة الجزيئية |
C9H11N3O3 |
الوزن الجزيئي الغرامي |
209.2019 |
InChI |
InChI=1/C9H11N3O3/c1-3-5-11-7(13)10-8(14)12(6-4-2)9(11)15/h3-4H,1-2,5-6H2,(H,10,13,14) |
إستراتيجية المساعدة القطرية |
6294-79-7 |
بنية جزيئية |
|
كثافة |
1.213g/cm3 |
معامل الإنكسار |
1.515 |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
|
|