ChemNet > CAS > 7549-37-3 citral dimethyl acetal, mixture of cis and T
7549-37-3 citral dimethyl acetal, mixture of cis and T
اسم المنتج |
citral dimethyl acetal, mixture of cis and T |
الاسم المستعار |
Citral dimethyl acetal; 1,1-Dimethoxy-3,7-Dimethyl-2,6-Octadiene; 1,1-dimethoxy-3,7-dimethylocta-2,6-diene; (2E)-1,1-dimethoxy-3,7-dimethylocta-2,6-diene; (2Z)-1,1-dimethoxy-3,7-dimethylocta-2,6-diene |
الصيغة الجزيئية |
C12H22O2 |
الوزن الجزيئي الغرامي |
198.3019 |
InChI |
InChI=1/C12H22O2/c1-10(2)7-6-8-11(3)9-12(13-4)14-5/h7,9,12H,6,8H2,1-5H3/b11-9- |
إستراتيجية المساعدة القطرية |
7549-37-3 |
المفوضية الأوروبية رقم |
231-434-0 |
بنية جزيئية |
|
كثافة |
0.875g/cm3 |
نقطة الغليان |
237.7°C at 760 mmHg |
معامل الإنكسار |
1.45 |
نقطة الوميض |
82.2°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R43:;
|
شروط الأمن |
S36/37:;
|
|