ChemNet > CAS > 771-56-2 methyl pentafluorobenzene
771-56-2 methyl pentafluorobenzene
اسم المنتج |
methyl pentafluorobenzene |
الاسم المستعار |
2,3,4,5,6-Pentafluorotoluene; Methylpentafluorobenzene |
الصيغة الجزيئية |
C7H3F5 |
الوزن الجزيئي الغرامي |
182.09 |
InChI |
InChI=1/C7H3F5/c1-2-3(8)5(10)7(12)6(11)4(2)9/h1H3 |
إستراتيجية المساعدة القطرية |
771-56-2 |
المفوضية الأوروبية رقم |
212-233-7 |
بنية جزيئية |
|
كثافة |
1.44 |
نقطة الغليان |
117℃ |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|