ChemNet > CAS > 777-84-4;79328-69-1 4-Nitrophenyl chloroacetate
777-84-4;79328-69-1 4-Nitrophenyl chloroacetate
| اسم المنتج |
4-Nitrophenyl chloroacetate |
| الاسم المستعار |
AI3-23373; Acetic acid, chloro-, 4-nitrophenyl ester |
| الصيغة الجزيئية |
C8H6ClNO4 |
| الوزن الجزيئي الغرامي |
215.5905 |
| InChI |
InChI=1/C8H6ClNO4/c9-5-8(11)14-7-3-1-6(2-4-7)10(12)13/h1-4H,5H2 |
| إستراتيجية المساعدة القطرية |
777-84-4;79328-69-1 |
| بنية جزيئية |
|
| كثافة |
1.434g/cm3 |
| درجة الإنصهار |
73-75℃ |
| نقطة الغليان |
334.5°C at 760 mmHg |
| معامل الإنكسار |
1.565 |
| نقطة الوميض |
156.1°C |
| علامات على البضائع الخطرة |
 Xi:Irritant;
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
