ChemNet > CAS > 81321-10-0 ميثيل 3-إيزوثيوسياناتوثيوفين-2-كربوكسيلات ؛
81321-10-0 ميثيل 3-إيزوثيوسياناتوثيوفين-2-كربوكسيلات ؛
| اسم المنتج |
ميثيل 3-إيزوثيوسياناتوثيوفين-2-كربوكسيلات ؛ |
| الاسم بالانجليزية |
methyl 3-isothiocyanatothiophene-2-carboxylate; |
| الصيغة الجزيئية |
C7H5NO2S2 |
| الوزن الجزيئي الغرامي |
199.2501 |
| InChI |
InChI=1/C7H5NO2S2/c1-10-7(9)6-5(8-4-11)2-3-12-6/h2-3H,1H3 |
| إستراتيجية المساعدة القطرية |
81321-10-0 |
| بنية جزيئية |
|
| كثافة |
1.35g/cm3 |
| درجة الإنصهار |
56℃ |
| نقطة الغليان |
340.3°C at 760 mmHg |
| معامل الإنكسار |
1.63 |
| نقطة الوميض |
159.6°C |
| ضغط البخار |
8.7E-05mmHg at 25°C |
| علامات على البضائع الخطرة |
Xn:Harmful;
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|