ChemNet > CAS > 95201-93-7 Methyl 4-bromo-3-hydroxythiophene-2-carboxylate
95201-93-7 Methyl 4-bromo-3-hydroxythiophene-2-carboxylate
اسم المنتج |
Methyl 4-bromo-3-hydroxythiophene-2-carboxylate |
الاسم المستعار |
4-bromo-2-[hydroxy(methoxy)methylidene]thiophen-3(2H)-one |
الصيغة الجزيئية |
C6H5BrO3S |
الوزن الجزيئي الغرامي |
237.0711 |
InChI |
InChI=1/C6H5BrO3S/c1-10-6(9)5-4(8)3(7)2-11-5/h2,8H,1H3 |
إستراتيجية المساعدة القطرية |
95201-93-7 |
بنية جزيئية |
|
كثافة |
1.804g/cm3 |
درجة الإنصهار |
79-80℃ |
نقطة الغليان |
247.887°C at 760 mmHg |
معامل الإنكسار |
1.617 |
نقطة الوميض |
103.718°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|