ChemNet > CAS > 96449-68-2 1-(4-fluorobenzyl)-5-oxo-3-pyrrolidinecarboxylic acid
96449-68-2 1-(4-fluorobenzyl)-5-oxo-3-pyrrolidinecarboxylic acid
| اسم المنتج |
1-(4-fluorobenzyl)-5-oxo-3-pyrrolidinecarboxylic acid |
| الاسم المستعار |
1-(4-fluorobenzyl)-5-oxopyrrolidine-3-carboxylic acid |
| الصيغة الجزيئية |
C12H12FNO3 |
| الوزن الجزيئي الغرامي |
237.227 |
| InChI |
InChI=1/C12H12FNO3/c13-10-3-1-8(2-4-10)6-14-7-9(12(16)17)5-11(14)15/h1-4,9H,5-7H2,(H,16,17) |
| إستراتيجية المساعدة القطرية |
96449-68-2 |
| بنية جزيئية |
|
| كثافة |
1.387g/cm3 |
| درجة الإنصهار |
149℃ |
| نقطة الغليان |
476.2°C at 760 mmHg |
| معامل الإنكسار |
1.586 |
| نقطة الوميض |
241.8°C |
| علامات على البضائع الخطرة |
 Xi:Irritant;
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
