CAS No: 6784-46-9, Chemical Name: (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-amine
the physical and chemical property of 6784-46-9, (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-amine is provided by ChemNet.com
ChemNet > CAS > 6784-46-9 (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-amine
6784-46-9 (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-amine
produktnavn |
(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-amine |
Synonymer |
2,6,10-Dodecatrien-1-amine, 3,7,11-trimethyl- |
Molekylær Formel |
C15H27N |
Molekylvekt |
221.3816 |
InChI |
InChI=1/C15H27N/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11H,5-6,8,10,12,16H2,1-4H3/b14-9+,15-11+ |
CAS-nummer |
6784-46-9 |
Molecular Structure |
|
Tetthet |
0.851g/cm3 |
Kokepunkt |
318.5°C at 760 mmHg |
Brytningsindeks |
1.486 |
Flammepunktet |
137.2°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
|
|