ChemNet > CAS > 10273-90-2 3-Methyl-2-phenylpyridine
10273-90-2 3-Methyl-2-phenylpyridine
Ürün Adı |
3-Methyl-2-phenylpyridine |
Eş anlamlı |
2-Phenyl-3-picoline |
Moleküler Formülü |
C12H11N |
Molekül Ağırlığı |
169.2224 |
InChI |
InChI=1/C12H11N/c1-10-6-5-9-13-12(10)11-7-3-2-4-8-11/h2-9H,1H3 |
CAS kayıt numarası |
10273-90-2 |
EINECS |
233-619-1 |
Moleküler Yapısı |
|
Yoğunluk |
1.03g/cm3 |
Kaynama noktası |
278.2°C at 760 mmHg |
Kırılma indisi |
1.568 |
Alevlenme noktası |
96.1°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|