ChemNet > CAS > 10531-43-8 2-bromo-1-(5-phenyl-2-thienyl)-1-ethanone
10531-43-8 2-bromo-1-(5-phenyl-2-thienyl)-1-ethanone
Ürün Adı |
2-bromo-1-(5-phenyl-2-thienyl)-1-ethanone |
Eş anlamlı |
2-bromo-1-(5-phenylthiophen-2-yl)ethanone |
Moleküler Formülü |
C12H9BrOS |
Molekül Ağırlığı |
281.1683 |
InChI |
InChI=1/C12H9BrOS/c13-8-10(14)12-7-6-11(15-12)9-4-2-1-3-5-9/h1-7H,8H2 |
CAS kayıt numarası |
10531-43-8 |
Moleküler Yapısı |
|
Yoğunluk |
1.488g/cm3 |
Kaynama noktası |
407.1°C at 760 mmHg |
Kırılma indisi |
1.627 |
Alevlenme noktası |
200°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|