ChemNet > CAS > 116493-07-3 4-siyano-3- (4-metoksifenil) -5- (metiltiyo) tiyofen-2-karboksilik asit
116493-07-3 4-siyano-3- (4-metoksifenil) -5- (metiltiyo) tiyofen-2-karboksilik asit
| Ürün Adı |
4-siyano-3- (4-metoksifenil) -5- (metiltiyo) tiyofen-2-karboksilik asit |
| Eş anlamlı |
4-siyano-3- (4-metoksifenil) -5- (metilsülfanil) tiyofen-2-karboksilik asit;
|
| ingilizce adı |
4-cyano-3-(4-methoxyphenyl)-5-(methylthio)thiophene-2-carboxylic acid;4-cyano-3-(4-methoxyphenyl)-5-(methylsulfanyl)thiophene-2-carboxylic acid |
| Moleküler Formülü |
C14H11NO3S2 |
| Molekül Ağırlığı |
305.372 |
| InChI |
InChI=1/C14H11NO3S2/c1-18-9-5-3-8(4-6-9)11-10(7-15)14(19-2)20-12(11)13(16)17/h3-6H,1-2H3,(H,16,17) |
| CAS kayıt numarası |
116493-07-3 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.43g/cm3 |
| Ergime noktası |
209℃ |
| Kaynama noktası |
464.9°C at 760 mmHg |
| Kırılma indisi |
1.67 |
| Alevlenme noktası |
234.9°C |
| Buhar basıncı |
1.93E-09mmHg at 25°C |
| Tehlike Sembolleri |
Xn:Harmful;
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik Açıklaması |
S36/37:Wear suitable protective clothing and gloves.;
|
|